C35H45ClFN5O4S — CID 153335921
tert-butyl 4-[3-[[6-[[2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 153335921) has the molecular formula C35H45ClFN5O4S and a molecular weight of 686.29 g/mol. Its IUPAC name is tert-butyl 4-[3-[[6-[[2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[6-[[2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 153335921 |
| Molecular Formula | C35H45ClFN5O4S |
| Molecular Weight | 686.29 g/mol |
| Exact Mass | 685.29 |
| IUPAC Name | tert-butyl 4-[3-[[6-[[2-chloro-6-[3-fluoro-5-(2-methylpropoxy)phenyl]pyridine-3-carbonyl]amino]sulfanyl-2-pyridinyl]amino]propyl]-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CC(C)COc1cc(F)cc(-c2ccc(C(=O)NSc3cccc(NCCCC4CN(C(=O)OC(C)(C)C)C(C)(C)C4)n3)c(Cl)n2)c1 |
| InChI | InChI=1S/C35H45ClFN5O4S/c1-22(2)21-45-26-17-24(16-25(37)18-26)28-14-13-27(31(36)39-28)32(43)41-47-30-12-8-11-29(40-30)38-15-9-10-23-19-35(6,7)42(20-23)33(44)46-34(3,4)5/h8,11-14,16-18,22-23H,9-10,15,19-21H2,1-7H3,(H,38,40)(H,41,43) |
| InChIKey | ZDTQMCHCSSBNOM-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.29 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|