C27H38N2O3S — CID 153336472
N-[(E)-(6-methoxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 153336472) has the molecular formula C27H38N2O3S and a molecular weight of 470.68 g/mol. Its IUPAC name is N-[(E)-(6-methoxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[(E)-(6-methoxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 153336472 |
| Molecular Formula | C27H38N2O3S |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | N-[(E)-(6-methoxy-3-methyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | COc1ccc2c(c1)CC(C)C/C2=N\NS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C27H38N2O3S/c1-16(2)20-14-24(17(3)4)27(25(15-20)18(5)6)33(30,31)29-28-26-12-19(7)11-21-13-22(32-8)9-10-23(21)26/h9-10,13-19,29H,11-12H2,1-8H3/b28-26+ |
| InChIKey | DWVZATHPBGMOST-BYCLXTJYSA-N |
| XLogP | 6.33 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|