C11H23N — CID 153336559
ethane;6-methyl-2-propan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 153336559) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;6-methyl-2-propan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | ethane;6-methyl-2-propan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 153336559 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;6-methyl-2-propan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CC.CC1C=CCC(C(C)C)N1 |
| InChI | InChI=1S/C9H17N.C2H6/c1-7(2)9-6-4-5-8(3)10-9;1-2/h4-5,7-10H,6H2,1-3H3;1-2H3 |
| InChIKey | XCCICBVRSHSKIP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|