About 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane
3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane (PubChem CID 153336772) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane.
Molecular Properties
| Compound Name | 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane |
| PubChem CID | 153336772 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane |
| SMILES | CC.OCCCN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C8H15F2NO.C2H6/c9-8(10)2-5-11(6-3-8)4-1-7-12;1-2/h12H,1-7H2;1-2H3 |
| InChIKey | MQFHMZGOFMXRFN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane?
The IUPAC name of 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane (CID 153336772) is 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane.
What is the SMILES notation for 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane?
The canonical SMILES for 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane is CC.OCCCN1CCC(F)(F)CC1.
What is the InChIKey of 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane?
The InChIKey is MQFHMZGOFMXRFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO.C2H6/c9-8(10)2-5-11(6-3-8)4-1-7-12;1-2/h12H,1-7H2;1-2H3.
What are the key properties of 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane?
3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane has a molecular weight of 209.28 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-difluoropiperidin-1-yl)propan-1-ol;ethane is sourced from PubChem (CID 153336772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).