About 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene
5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene (PubChem CID 153337167) has the molecular formula C18H29FN2
and a molecular weight of 292.44 g/mol. Its IUPAC name is 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene.
Molecular Properties
| Compound Name | 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene |
| PubChem CID | 153337167 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene |
| SMILES | CCC1=CN(C2CCN(CC(C)(C)F)CC2)CC2CC2=C1 |
| InChI | InChI=1S/C18H29FN2/c1-4-14-9-15-10-16(15)12-21(11-14)17-5-7-20(8-6-17)13-18(2,3)19/h9,11,16-17H,4-8,10,12-13H2,1-3H3 |
| InChIKey | RLMDXIRRZAUENZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene?
The IUPAC name of 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene (CID 153337167) is 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene.
What is the SMILES notation for 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene?
The canonical SMILES for 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene is CCC1=CN(C2CCN(CC(C)(C)F)CC2)CC2CC2=C1.
What is the InChIKey of 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene?
The InChIKey is RLMDXIRRZAUENZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29FN2/c1-4-14-9-15-10-16(15)12-21(11-14)17-5-7-20(8-6-17)13-18(2,3)19/h9,11,16-17H,4-8,10,12-13H2,1-3H3.
What are the key properties of 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene?
5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene has a molecular weight of 292.44 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]-3-azabicyclo[5.1.0]octa-4,6-diene is sourced from PubChem (CID 153337167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).