C24H27FN2O4S — CID 153337557
methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfanylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate (PubChem CID 153337557) has the molecular formula C24H27FN2O4S and a molecular weight of 458.56 g/mol. Its IUPAC name is methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfanylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate.
| Compound Name | methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfanylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate |
|---|---|
| PubChem CID | 153337557 |
| Molecular Formula | C24H27FN2O4S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | methyl 8-[[2-fluoro-5-(2-hydroxypropan-2-yl)phenyl]sulfanylcarbamoylamino]-1,2,3,5,6,7-hexahydro-s-indacene-4-carboxylate |
| SMILES | COC(=O)c1c2c(c(NC(=O)NSc3cc(C(C)(C)O)ccc3F)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C24H27FN2O4S/c1-24(2,30)13-10-11-18(25)19(12-13)32-27-23(29)26-21-16-8-4-6-14(16)20(22(28)31-3)15-7-5-9-17(15)21/h10-12,30H,4-9H2,1-3H3,(H2,26,27,29) |
| InChIKey | URGAHQSQHPRCNB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|