C21H22BrN3O3 — CID 153337782
4-(4-bromo-2-oxo-3H-benzimidazol-1-yl)-N-(4-hydroxy-3-methylphenyl)cyclohexane-1-carboxamide (PubChem CID 153337782) has the molecular formula C21H22BrN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 4-(4-bromo-2-oxo-3H-benzimidazol-1-yl)-N-(4-hydroxy-3-methylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-bromo-2-oxo-3H-benzimidazol-1-yl)-N-(4-hydroxy-3-methylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 153337782 |
| Molecular Formula | C21H22BrN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 4-(4-bromo-2-oxo-3H-benzimidazol-1-yl)-N-(4-hydroxy-3-methylphenyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCC(n3c(=O)[nH]c4c(Br)cccc43)CC2)ccc1O |
| InChI | InChI=1S/C21H22BrN3O3/c1-12-11-14(7-10-18(12)26)23-20(27)13-5-8-15(9-6-13)25-17-4-2-3-16(22)19(17)24-21(25)28/h2-4,7,10-11,13,15,26H,5-6,8-9H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | OFHJZLHWZNNKKA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|