About N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine
N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine (PubChem CID 153337806) has the molecular formula C8H13F2N
and a molecular weight of 161.19 g/mol. Its IUPAC name is N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine.
Molecular Properties
| Compound Name | N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine |
| PubChem CID | 153337806 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine |
| SMILES | C/C=C(C)\N=C(/C)C(C)(F)F |
| InChI | InChI=1S/C8H13F2N/c1-5-6(2)11-7(3)8(4,9)10/h5H,1-4H3/b6-5-,11-7+ |
| InChIKey | DOGKNULDWJMOHM-GNLLZQBYSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine?
The IUPAC name of N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine (CID 153337806) is N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine.
What is the SMILES notation for N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine?
The canonical SMILES for N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine is C/C=C(C)\N=C(/C)C(C)(F)F.
What is the InChIKey of N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine?
The InChIKey is DOGKNULDWJMOHM-GNLLZQBYSA-N. The full InChI is InChI=1S/C8H13F2N/c1-5-6(2)11-7(3)8(4,9)10/h5H,1-4H3/b6-5-,11-7+.
What are the key properties of N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine?
N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine has a molecular weight of 161.19 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-2-en-2-yl]-3,3-difluorobutan-2-imine is sourced from PubChem (CID 153337806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).