C16H18F2N2O — CID 153337833
1-[[4-[(E)-1-(2,2-difluoroethylideneamino)prop-1-enyl]phenyl]methyl]pyrrolidin-2-one (PubChem CID 153337833) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[[4-[(E)-1-(2,2-difluoroethylideneamino)prop-1-enyl]phenyl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[4-[(E)-1-(2,2-difluoroethylideneamino)prop-1-enyl]phenyl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 153337833 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[[4-[(E)-1-(2,2-difluoroethylideneamino)prop-1-enyl]phenyl]methyl]pyrrolidin-2-one |
| SMILES | C/C=C(/N=C/C(F)F)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C16H18F2N2O/c1-2-14(19-10-15(17)18)13-7-5-12(6-8-13)11-20-9-3-4-16(20)21/h2,5-8,10,15H,3-4,9,11H2,1H3/b14-2+,19-10+ |
| InChIKey | YCGXAVNKMGNJNL-GPGIENBVSA-N |
| XLogP | 3.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|