About 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane
6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane (PubChem CID 153338091) has the molecular formula C8H13ClN2O2
and a molecular weight of 204.66 g/mol. Its IUPAC name is 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane.
Molecular Properties
| Compound Name | 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane |
| PubChem CID | 153338091 |
| Molecular Formula | C8H13ClN2O2 |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane |
| SMILES | CC.Cc1c(CCl)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H7ClN2O2.C2H6/c1-3-4(2-7)8-6(11)9-5(3)10;1-2/h2H2,1H3,(H2,8,9,10,11);1-2H3 |
| InChIKey | DBGWQTFIULTZOD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane?
The IUPAC name of 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane (CID 153338091) is 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane.
What is the SMILES notation for 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane?
The canonical SMILES for 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane is CC.Cc1c(CCl)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane?
The InChIKey is DBGWQTFIULTZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2.C2H6/c1-3-4(2-7)8-6(11)9-5(3)10;1-2/h2H2,1H3,(H2,8,9,10,11);1-2H3.
What are the key properties of 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane?
6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane has a molecular weight of 204.66 g/mol, XLogP of 1.14, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-5-methyl-1H-pyrimidine-2,4-dione;ethane is sourced from PubChem (CID 153338091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).