C16H18ClO2P — CID 153338124
[4-chloro-3-[(4-ethoxyphenyl)-phosphanylmethyl]phenyl]methanol (PubChem CID 153338124) has the molecular formula C16H18ClO2P and a molecular weight of 308.75 g/mol. Its IUPAC name is [4-chloro-3-[(4-ethoxyphenyl)-phosphanylmethyl]phenyl]methanol.
| Compound Name | [4-chloro-3-[(4-ethoxyphenyl)-phosphanylmethyl]phenyl]methanol |
|---|---|
| PubChem CID | 153338124 |
| Molecular Formula | C16H18ClO2P |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | [4-chloro-3-[(4-ethoxyphenyl)-phosphanylmethyl]phenyl]methanol |
| SMILES | CCOc1ccc(C(P)c2cc(CO)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClO2P/c1-2-19-13-6-4-12(5-7-13)16(20)14-9-11(10-18)3-8-15(14)17/h3-9,16,18H,2,10,20H2,1H3 |
| InChIKey | DVTDTYJIEJYBHM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|