About 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one
1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one (PubChem CID 153338522) has the molecular formula C20H32F2N2O
and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one |
| PubChem CID | 153338522 |
| Molecular Formula | C20H32F2N2O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one |
| SMILES | CCN.Cc1cc(F)c(F)cc1C1CCCCC1.O=C1CCCCN1 |
| InChI | InChI=1S/C13H16F2.C5H9NO.C2H7N/c1-9-7-12(14)13(15)8-11(9)10-5-3-2-4-6-10;7-5-3-1-2-4-6-5;1-2-3/h7-8,10H,2-6H2,1H3;1-4H2,(H,6,7);2-3H2,1H3 |
| InChIKey | MENDBZWEFKOYDO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one?
The IUPAC name of 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one (CID 153338522) is 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one.
What is the SMILES notation for 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one?
The canonical SMILES for 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one is CCN.Cc1cc(F)c(F)cc1C1CCCCC1.O=C1CCCCN1.
What is the InChIKey of 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one?
The InChIKey is MENDBZWEFKOYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16F2.C5H9NO.C2H7N/c1-9-7-12(14)13(15)8-11(9)10-5-3-2-4-6-10;7-5-3-1-2-4-6-5;1-2-3/h7-8,10H,2-6H2,1H3;1-4H2,(H,6,7);2-3H2,1H3.
What are the key properties of 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one?
1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one has a molecular weight of 354.49 g/mol, XLogP of 4.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4,5-difluoro-2-methylbenzene;ethanamine;piperidin-2-one is sourced from PubChem (CID 153338522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).