About N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine
N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine (PubChem CID 153338531) has the molecular formula C19H27F2NO
and a molecular weight of 323.43 g/mol. Its IUPAC name is N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine.
Molecular Properties
| Compound Name | N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine |
| PubChem CID | 153338531 |
| Molecular Formula | C19H27F2NO |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine |
| SMILES | Fc1ccc(C2CCC(CCNC3CCOCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H27F2NO/c20-16-5-6-18(19(21)13-16)15-3-1-14(2-4-15)7-10-22-17-8-11-23-12-9-17/h5-6,13-15,17,22H,1-4,7-12H2 |
| InChIKey | KNOQPXRQJWVZSB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine?
The IUPAC name of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine (CID 153338531) is N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine.
What is the SMILES notation for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine?
The canonical SMILES for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine is Fc1ccc(C2CCC(CCNC3CCOCC3)CC2)c(F)c1.
What is the InChIKey of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine?
The InChIKey is KNOQPXRQJWVZSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F2NO/c20-16-5-6-18(19(21)13-16)15-3-1-14(2-4-15)7-10-22-17-8-11-23-12-9-17/h5-6,13-15,17,22H,1-4,7-12H2.
What are the key properties of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine?
N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine has a molecular weight of 323.43 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]oxan-4-amine is sourced from PubChem (CID 153338531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).