About N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine
N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine (PubChem CID 153338544) has the molecular formula C19H27F2N
and a molecular weight of 307.43 g/mol. Its IUPAC name is N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine.
Molecular Properties
| Compound Name | N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine |
| PubChem CID | 153338544 |
| Molecular Formula | C19H27F2N |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine |
| SMILES | Fc1ccc(C2CCC(CCNC3CCCC3)CC2)c(F)c1 |
| InChI | InChI=1S/C19H27F2N/c20-16-9-10-18(19(21)13-16)15-7-5-14(6-8-15)11-12-22-17-3-1-2-4-17/h9-10,13-15,17,22H,1-8,11-12H2 |
| InChIKey | IYNPQYVBKOQPCV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine?
The IUPAC name of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine (CID 153338544) is N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine.
What is the SMILES notation for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine?
The canonical SMILES for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine is Fc1ccc(C2CCC(CCNC3CCCC3)CC2)c(F)c1.
What is the InChIKey of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine?
The InChIKey is IYNPQYVBKOQPCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27F2N/c20-16-9-10-18(19(21)13-16)15-7-5-14(6-8-15)11-12-22-17-3-1-2-4-17/h9-10,13-15,17,22H,1-8,11-12H2.
What are the key properties of N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine?
N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine has a molecular weight of 307.43 g/mol, XLogP of 5.16, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[4-(2,4-difluorophenyl)cyclohexyl]ethyl]cyclopentanamine is sourced from PubChem (CID 153338544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).