About (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane
(3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane (PubChem CID 153338653) has the molecular formula C15H23BrO2S
and a molecular weight of 347.32 g/mol. Its IUPAC name is (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane.
Molecular Properties
| Compound Name | (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane |
| PubChem CID | 153338653 |
| Molecular Formula | C15H23BrO2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane |
| SMILES | CC1CCCC(OC(=O)c2cc(Br)cs2)C1.CCC |
| InChI | InChI=1S/C12H15BrO2S.C3H8/c1-8-3-2-4-10(5-8)15-12(14)11-6-9(13)7-16-11;1-3-2/h6-8,10H,2-5H2,1H3;3H2,1-2H3 |
| InChIKey | OWXSTLDMJDOCKC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane?
The IUPAC name of (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane (CID 153338653) is (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane.
What is the SMILES notation for (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane?
The canonical SMILES for (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane is CC1CCCC(OC(=O)c2cc(Br)cs2)C1.CCC.
What is the InChIKey of (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane?
The InChIKey is OWXSTLDMJDOCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrO2S.C3H8/c1-8-3-2-4-10(5-8)15-12(14)11-6-9(13)7-16-11;1-3-2/h6-8,10H,2-5H2,1H3;3H2,1-2H3.
What are the key properties of (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane?
(3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane has a molecular weight of 347.32 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclohexyl) 4-bromothiophene-2-carboxylate;propane is sourced from PubChem (CID 153338653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).