About cyclohexa-1,5-dien-1-ylmethanesulfinamide
cyclohexa-1,5-dien-1-ylmethanesulfinamide (PubChem CID 153339211) has the molecular formula C7H11NOS
and a molecular weight of 157.24 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-ylmethanesulfinamide.
Molecular Properties
| Compound Name | cyclohexa-1,5-dien-1-ylmethanesulfinamide |
| PubChem CID | 153339211 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | cyclohexa-1,5-dien-1-ylmethanesulfinamide |
| SMILES | NS(=O)CC1=CCCC=C1 |
| InChI | InChI=1S/C7H11NOS/c8-10(9)6-7-4-2-1-3-5-7/h2,4-5H,1,3,6,8H2 |
| InChIKey | CMHLTCJVYPOJBM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexa-1,5-dien-1-ylmethanesulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,5-dien-1-ylmethanesulfinamide?
The IUPAC name of cyclohexa-1,5-dien-1-ylmethanesulfinamide (CID 153339211) is cyclohexa-1,5-dien-1-ylmethanesulfinamide.
What is the SMILES notation for cyclohexa-1,5-dien-1-ylmethanesulfinamide?
The canonical SMILES for cyclohexa-1,5-dien-1-ylmethanesulfinamide is NS(=O)CC1=CCCC=C1.
What is the InChIKey of cyclohexa-1,5-dien-1-ylmethanesulfinamide?
The InChIKey is CMHLTCJVYPOJBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NOS/c8-10(9)6-7-4-2-1-3-5-7/h2,4-5H,1,3,6,8H2.
What are the key properties of cyclohexa-1,5-dien-1-ylmethanesulfinamide?
cyclohexa-1,5-dien-1-ylmethanesulfinamide has a molecular weight of 157.24 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,5-dien-1-ylmethanesulfinamide is sourced from PubChem (CID 153339211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).