C24H40F2N3O9P — CID 153339522
[[5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4,4-difluorooxolan-2-yl]methoxy-(3,3-dimethylbutanoyloxymethoxy)phosphanyl]oxymethyl 3,3-dimethylbutanoate (PubChem CID 153339522) has the molecular formula C24H40F2N3O9P and a molecular weight of 583.57 g/mol. Its IUPAC name is [[5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4,4-difluorooxolan-2-yl]methoxy-(3,3-dimethylbutanoyloxymethoxy)phosphanyl]oxymethyl 3,3-dimethylbutanoate.
| Compound Name | [[5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4,4-difluorooxolan-2-yl]methoxy-(3,3-dimethylbutanoyloxymethoxy)phosphanyl]oxymethyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 153339522 |
| Molecular Formula | C24H40F2N3O9P |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | [[5-[[(Z)-3-amino-3-methyliminoprop-1-enyl]-formylamino]-4,4-difluorooxolan-2-yl]methoxy-(3,3-dimethylbutanoyloxymethoxy)phosphanyl]oxymethyl 3,3-dimethylbutanoate |
| SMILES | C/N=C(N)/C=C\N(C=O)C1OC(COP(OCOC(=O)CC(C)(C)C)OCOC(=O)CC(C)(C)C)CC1(F)F |
| InChI | InChI=1S/C24H40F2N3O9P/c1-22(2,3)11-19(31)33-15-36-39(37-16-34-20(32)12-23(4,5)6)35-13-17-10-24(25,26)21(38-17)29(14-30)9-8-18(27)28-7/h8-9,14,17,21H,10-13,15-16H2,1-7H3,(H2,27,28)/b9-8- |
| InChIKey | DEWAQFRSIMFWPF-HJWRWDBZSA-N |
| XLogP | 3.85 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|