C46H36N4S — CID 153340681
N-[amino-[3-[4-(4-cyanocyclohexa-2,4-dien-1-yl)-8-phenyldibenzothiophen-1-yl]cyclohexa-1,3-dien-1-yl]methylidene]-N'-benzylbenzenecarboximidamide (PubChem CID 153340681) has the molecular formula C46H36N4S and a molecular weight of 676.89 g/mol. Its IUPAC name is N-[amino-[3-[4-(4-cyanocyclohexa-2,4-dien-1-yl)-8-phenyldibenzothiophen-1-yl]cyclohexa-1,3-dien-1-yl]methylidene]-N'-benzylbenzenecarboximidamide.
| Compound Name | N-[amino-[3-[4-(4-cyanocyclohexa-2,4-dien-1-yl)-8-phenyldibenzothiophen-1-yl]cyclohexa-1,3-dien-1-yl]methylidene]-N'-benzylbenzenecarboximidamide |
|---|---|
| PubChem CID | 153340681 |
| Molecular Formula | C46H36N4S |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.27 |
| IUPAC Name | N-[amino-[3-[4-(4-cyanocyclohexa-2,4-dien-1-yl)-8-phenyldibenzothiophen-1-yl]cyclohexa-1,3-dien-1-yl]methylidene]-N'-benzylbenzenecarboximidamide |
| SMILES | N#CC1=CCC(c2ccc(C3=CCCC(/C(N)=N/C(=N/Cc4ccccc4)c4ccccc4)=C3)c3c2sc2ccc(-c4ccccc4)cc23)C=C1 |
| InChI | InChI=1S/C46H36N4S/c47-29-31-19-21-34(22-20-31)40-25-24-39(43-41-28-36(33-13-6-2-7-14-33)23-26-42(41)51-44(40)43)37-17-10-18-38(27-37)45(48)50-46(35-15-8-3-9-16-35)49-30-32-11-4-1-5-12-32/h1-9,11-17,19-21,23-28,34H,10,18,22,30H2,(H2,48,49,50) |
| InChIKey | JXTKFXUPAKAESZ-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|