About CID 153340922
CID 153340922 (PubChem CID 153340922) has the molecular formula C10H13KN2O
and a molecular weight of 216.33 g/mol.
Molecular Properties
| Compound Name | CID 153340922 |
| PubChem CID | 153340922 |
| Molecular Formula | C10H13KN2O |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | — |
| SMILES | CC.O=C1NCC2=C1C=C[CH-]C=N2.[K+] |
| InChI | InChI=1S/C8H7N2O.C2H6.K/c11-8-6-3-1-2-4-9-7(6)5-10-8;1-2;/h1-4H,5H2,(H,10,11);1-2H3;/q-1;;+1 |
| InChIKey | NBKNKGFNWGIJDY-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 153340922 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 153340922?
The IUPAC name of CID 153340922 (CID 153340922) is not available.
What is the SMILES notation for CID 153340922?
The canonical SMILES for CID 153340922 is CC.O=C1NCC2=C1C=C[CH-]C=N2.[K+].
What is the InChIKey of CID 153340922?
The InChIKey is NBKNKGFNWGIJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2O.C2H6.K/c11-8-6-3-1-2-4-9-7(6)5-10-8;1-2;/h1-4H,5H2,(H,10,11);1-2H3;/q-1;;+1.
What are the key properties of CID 153340922?
CID 153340922 has a molecular weight of 216.33 g/mol, XLogP of -1.75, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 153340922 is sourced from PubChem (CID 153340922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).