About 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane
4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane (PubChem CID 153341678) has the molecular formula C8H13ClO4
and a molecular weight of 208.64 g/mol. Its IUPAC name is 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane.
Molecular Properties
| Compound Name | 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane |
| PubChem CID | 153341678 |
| Molecular Formula | C8H13ClO4 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane |
| SMILES | CC.Cc1oc(=O)oc1COCCl |
| InChI | InChI=1S/C6H7ClO4.C2H6/c1-4-5(2-9-3-7)11-6(8)10-4;1-2/h2-3H2,1H3;1-2H3 |
| InChIKey | LTZGHKMCRZAFOI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane?
The IUPAC name of 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane (CID 153341678) is 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane.
What is the SMILES notation for 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane?
The canonical SMILES for 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane is CC.Cc1oc(=O)oc1COCCl.
What is the InChIKey of 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane?
The InChIKey is LTZGHKMCRZAFOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO4.C2H6/c1-4-5(2-9-3-7)11-6(8)10-4;1-2/h2-3H2,1H3;1-2H3.
What are the key properties of 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane?
4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane has a molecular weight of 208.64 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethoxymethyl)-5-methyl-1,3-dioxol-2-one;ethane is sourced from PubChem (CID 153341678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).