About 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one
2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one (PubChem CID 153341731) has the molecular formula C23H23N3O
and a molecular weight of 357.46 g/mol. Its IUPAC name is 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one.
Molecular Properties
| Compound Name | 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one |
| PubChem CID | 153341731 |
| Molecular Formula | C23H23N3O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one |
| SMILES | C=C1C2=CCCC=C2Nc2nc(C3CCCC3)n(-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C23H23N3O/c1-15-18-13-7-8-14-19(18)24-21-20(15)23(27)26(17-11-3-2-4-12-17)22(25-21)16-9-5-6-10-16/h2-4,11-14,16,24H,1,5-10H2 |
| InChIKey | NKEIEFKHOCXISQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one?
The IUPAC name of 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one (CID 153341731) is 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one.
What is the SMILES notation for 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one?
The canonical SMILES for 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one is C=C1C2=CCCC=C2Nc2nc(C3CCCC3)n(-c3ccccc3)c(=O)c21.
What is the InChIKey of 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one?
The InChIKey is NKEIEFKHOCXISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N3O/c1-15-18-13-7-8-14-19(18)24-21-20(15)23(27)26(17-11-3-2-4-12-17)22(25-21)16-9-5-6-10-16/h2-4,11-14,16,24H,1,5-10H2.
What are the key properties of 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one?
2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one has a molecular weight of 357.46 g/mol, XLogP of 4.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-5-methylidene-3-phenyl-8,10-dihydro-7H-pyrimido[4,5-b]quinolin-4-one is sourced from PubChem (CID 153341731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).