About methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea
methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea (PubChem CID 153341809) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea.
Molecular Properties
| Compound Name | methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea |
| PubChem CID | 153341809 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea |
| SMILES | CC(C)CNC(=O)Nc1ccccc1.COC1CCCC1 |
| InChI | InChI=1S/C11H16N2O.C6H12O/c1-9(2)8-12-11(14)13-10-6-4-3-5-7-10;1-7-6-4-2-3-5-6/h3-7,9H,8H2,1-2H3,(H2,12,13,14);6H,2-5H2,1H3 |
| InChIKey | AEIOBBOKYWZRFB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea?
The IUPAC name of methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea (CID 153341809) is methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea.
What is the SMILES notation for methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea?
The canonical SMILES for methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea is CC(C)CNC(=O)Nc1ccccc1.COC1CCCC1.
What is the InChIKey of methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea?
The InChIKey is AEIOBBOKYWZRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O.C6H12O/c1-9(2)8-12-11(14)13-10-6-4-3-5-7-10;1-7-6-4-2-3-5-6/h3-7,9H,8H2,1-2H3,(H2,12,13,14);6H,2-5H2,1H3.
What are the key properties of methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea?
methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea has a molecular weight of 292.42 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea is sourced from PubChem (CID 153341809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).