C17H28N2O2 — CID 153341809
methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea (PubChem CID 153341809) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea.
| Compound Name | methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea |
|---|---|
| PubChem CID | 153341809 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | methoxycyclopentane;1-(2-methylpropyl)-3-phenylurea |
| SMILES | CC(C)CNC(=O)Nc1ccccc1.COC1CCCC1 |
| InChI | InChI=1S/C11H16N2O.C6H12O/c1-9(2)8-12-11(14)13-10-6-4-3-5-7-10;1-7-6-4-2-3-5-6/h3-7,9H,8H2,1-2H3,(H2,12,13,14);6H,2-5H2,1H3 |
| InChIKey | AEIOBBOKYWZRFB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |