C23H40N2O7Si2 — CID 15334181
(1S,3S,6'aR,9'aS)-1-methyl-2',2',4',4'-tetra(propan-2-yl)spiro[1H-[1,3]oxazolo[3,4-c]pyrimidine-3,8'-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine]-5,7-dione (PubChem CID 15334181) has the molecular formula C23H40N2O7Si2 and a molecular weight of 512.75 g/mol. Its IUPAC name is (1S,3S,6'aR,9'aS)-1-methyl-2',2',4',4'-tetra(propan-2-yl)spiro[1H-[1,3]oxazolo[3,4-c]pyrimidine-3,8'-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine]-5,7-dione.
| Compound Name | (1S,3S,6'aR,9'aS)-1-methyl-2',2',4',4'-tetra(propan-2-yl)spiro[1H-[1,3]oxazolo[3,4-c]pyrimidine-3,8'-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine]-5,7-dione |
|---|---|
| PubChem CID | 15334181 |
| Molecular Formula | C23H40N2O7Si2 |
| Molecular Weight | 512.75 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (1S,3S,6'aR,9'aS)-1-methyl-2',2',4',4'-tetra(propan-2-yl)spiro[1H-[1,3]oxazolo[3,4-c]pyrimidine-3,8'-6,6a,9,9a-tetrahydrofuro[3,2-f][1,3,5,2,4]trioxadisilocine]-5,7-dione |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@]3(C[C@@H]2O[Si](C(C)C)(C(C)C)O1)O[C@@H](C)c1cc(=O)[nH]c(=O)n13 |
| InChI | InChI=1S/C23H40N2O7Si2/c1-13(2)33(14(3)4)28-12-20-19(31-34(32-33,15(5)6)16(7)8)11-23(30-20)25-18(17(9)29-23)10-21(26)24-22(25)27/h10,13-17,19-20H,11-12H2,1-9H3,(H,24,26,27)/t17-,19-,20+,23-/m0/s1 |
| InChIKey | ARUVDKGXDOYRJJ-YPIYEQTHSA-N |
| XLogP | 3.98 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.75 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|