C18H17FN2O7P+ — CID 153341870
5-ethynyl-1-[5-[(6-fluoro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 153341870) has the molecular formula C18H17FN2O7P+ and a molecular weight of 423.31 g/mol. Its IUPAC name is 5-ethynyl-1-[5-[(6-fluoro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-ethynyl-1-[5-[(6-fluoro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 153341870 |
| Molecular Formula | C18H17FN2O7P+ |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 5-ethynyl-1-[5-[(6-fluoro-2-hydroxy-4H-1,3,2-benzodioxaphosphinin-2-ium-2-yl)oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C#Cc1cn(C2CCC(CO[P+]3(O)OCc4cc(F)ccc4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H16FN2O7P/c1-2-11-8-21(18(23)20-17(11)22)16-6-4-14(27-16)10-26-29(24)25-9-12-7-13(19)3-5-15(12)28-29/h1,3,5,7-8,14,16,24H,4,6,9-10H2/p+1 |
| InChIKey | CLLUAYNYAMPZLZ-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|