C18H16FN2O5PS — CID 153341991
5-ethynyl-1-[5-[(6-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 153341991) has the molecular formula C18H16FN2O5PS and a molecular weight of 422.37 g/mol. Its IUPAC name is 5-ethynyl-1-[5-[(6-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-ethynyl-1-[5-[(6-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 153341991 |
| Molecular Formula | C18H16FN2O5PS |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 5-ethynyl-1-[5-[(6-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethyl]oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | C#Cc1cn(C2CCC(COP3OCc4cc(F)ccc4O3)O2)c(=S)[nH]c1=O |
| InChI | InChI=1S/C18H16FN2O5PS/c1-2-11-8-21(18(28)20-17(11)22)16-6-4-14(25-16)10-24-27-23-9-12-7-13(19)3-5-15(12)26-27/h1,3,5,7-8,14,16H,4,6,9-10H2,(H,20,22,28) |
| InChIKey | NMQBPCCLUVWOCK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|