C18H25N2O7PS — CID 153342031
(6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;1-[(3S)-3-hydroxy-3-methoxypropyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 153342031) has the molecular formula C18H25N2O7PS and a molecular weight of 444.45 g/mol. Its IUPAC name is (6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;1-[(3S)-3-hydroxy-3-methoxypropyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | (6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;1-[(3S)-3-hydroxy-3-methoxypropyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 153342031 |
| Molecular Formula | C18H25N2O7PS |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (6,8-dimethyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxymethanol;1-[(3S)-3-hydroxy-3-methoxypropyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CO[C@H](O)CCn1ccc(=O)[nH]c1=S.Cc1cc(C)c2c(c1)COP(OCO)O2 |
| InChI | InChI=1S/C10H13O4P.C8H12N2O3S/c1-7-3-8(2)10-9(4-7)5-12-15(14-10)13-6-11;1-13-7(12)3-5-10-4-2-6(11)9-8(10)14/h3-4,11H,5-6H2,1-2H3;2,4,7,12H,3,5H2,1H3,(H,9,11,14)/t;7-/m.0/s1 |
| InChIKey | YAXWGCYPHSLWSF-ZLTKDMPESA-N |
| XLogP | 2.67 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|