About [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate
[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate (PubChem CID 153342218) has the molecular formula C16H14ClFN2O6
and a molecular weight of 384.75 g/mol. Its IUPAC name is [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate |
| PubChem CID | 153342218 |
| Molecular Formula | C16H14ClFN2O6 |
| Molecular Weight | 384.75 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate |
| SMILES | O=C(OCC1(F)CCC(O)(n2ccc(=O)[nH]c2=O)O1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN2O6/c17-11-3-1-2-10(8-11)13(22)25-9-15(18)5-6-16(24,26-15)20-7-4-12(21)19-14(20)23/h1-4,7-8,24H,5-6,9H2,(H,19,21,23) |
| InChIKey | OJJMYYPDLGRZSN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate?
The IUPAC name of [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate (CID 153342218) is [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate.
What is the SMILES notation for [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate?
The canonical SMILES for [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate is O=C(OCC1(F)CCC(O)(n2ccc(=O)[nH]c2=O)O1)c1cccc(Cl)c1.
What is the InChIKey of [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate?
The InChIKey is OJJMYYPDLGRZSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClFN2O6/c17-11-3-1-2-10(8-11)13(22)25-9-15(18)5-6-16(24,26-15)20-7-4-12(21)19-14(20)23/h1-4,7-8,24H,5-6,9H2,(H,19,21,23).
What are the key properties of [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate?
[5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate has a molecular weight of 384.75 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-5-hydroxyoxolan-2-yl]methyl 3-chlorobenzoate is sourced from PubChem (CID 153342218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).