C19H19N2O9P — CID 153342256
1-[5-[dihydroxy-[(6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione (PubChem CID 153342256) has the molecular formula C19H19N2O9P and a molecular weight of 450.34 g/mol. Its IUPAC name is 1-[5-[dihydroxy-[(6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione.
| Compound Name | 1-[5-[dihydroxy-[(6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 153342256 |
| Molecular Formula | C19H19N2O9P |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-[5-[dihydroxy-[(6-methyl-2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)oxy]methyl]oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione |
| SMILES | C#Cc1cn(C2CCC(C(O)(O)OP3(=O)OCc4cc(C)ccc4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H19N2O9P/c1-3-12-9-21(18(23)20-17(12)22)16-7-6-15(28-16)19(24,25)30-31(26)27-10-13-8-11(2)4-5-14(13)29-31/h1,4-5,8-9,15-16,24-25H,6-7,10H2,2H3,(H,20,22,23) |
| InChIKey | SUFIWQSSTVFJOT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|