C11H16N2O7 — CID 153342466
(Z)-2-formyl-3-[formyl-[5-(trihydroxymethyl)oxolan-2-yl]amino]-N-methylprop-2-enamide (PubChem CID 153342466) has the molecular formula C11H16N2O7 and a molecular weight of 288.26 g/mol. Its IUPAC name is (Z)-2-formyl-3-[formyl-[5-(trihydroxymethyl)oxolan-2-yl]amino]-N-methylprop-2-enamide.
| Compound Name | (Z)-2-formyl-3-[formyl-[5-(trihydroxymethyl)oxolan-2-yl]amino]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 153342466 |
| Molecular Formula | C11H16N2O7 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (Z)-2-formyl-3-[formyl-[5-(trihydroxymethyl)oxolan-2-yl]amino]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(C=O)=C\N(C=O)C1CCC(C(O)(O)O)O1 |
| InChI | InChI=1S/C11H16N2O7/c1-12-10(16)7(5-14)4-13(6-15)9-3-2-8(20-9)11(17,18)19/h4-6,8-9,17-19H,2-3H2,1H3,(H,12,16)/b7-4- |
| InChIKey | FOXXXHMFDIXQMH-DAXSKMNVSA-N |
| XLogP | -2.59 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|