C29H39N3O2 — CID 153342919
4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-7-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-2,3-dihydro-1,4-benzoxazepin-5-one;ethane (PubChem CID 153342919) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-7-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-2,3-dihydro-1,4-benzoxazepin-5-one;ethane.
| Compound Name | 4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-7-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-2,3-dihydro-1,4-benzoxazepin-5-one;ethane |
|---|---|
| PubChem CID | 153342919 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | 4-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-7-[[(2E,4Z)-hexa-2,4-dien-3-yl]amino]-2,3-dihydro-1,4-benzoxazepin-5-one;ethane |
| SMILES | C/C=C\C(=C/C)Nc1ccc2c(c1)C(=O)N(CCCN1CCc3ccccc3C1)CCO2.CC |
| InChI | InChI=1S/C27H33N3O2.C2H6/c1-3-8-23(4-2)28-24-11-12-26-25(19-24)27(31)30(17-18-32-26)15-7-14-29-16-13-21-9-5-6-10-22(21)20-29;1-2/h3-6,8-12,19,28H,7,13-18,20H2,1-2H3;1-2H3/b8-3-,23-4+; |
| InChIKey | BNXBGUZVYRFOGX-RLISBGNCSA-N |
| XLogP | 5.89 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|