C24H23N7O3S — CID 153343168
5-[(E)-[5-[4-[diazenyl(hydrazinyl)methylidene]cyclohexa-2,5-dien-1-ylidene]pyrrol-2-ylidene]methyl]-6-hydroxy-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 153343168) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 5-[(E)-[5-[4-[diazenyl(hydrazinyl)methylidene]cyclohexa-2,5-dien-1-ylidene]pyrrol-2-ylidene]methyl]-6-hydroxy-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 5-[(E)-[5-[4-[diazenyl(hydrazinyl)methylidene]cyclohexa-2,5-dien-1-ylidene]pyrrol-2-ylidene]methyl]-6-hydroxy-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 153343168 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 5-[(E)-[5-[4-[diazenyl(hydrazinyl)methylidene]cyclohexa-2,5-dien-1-ylidene]pyrrol-2-ylidene]methyl]-6-hydroxy-1-[2-(4-hydroxyphenyl)ethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | [H]/N=N/C(NN)=c1ccc(=c2cc/c(=C\c3c(O)n(CCc4ccc(O)cc4)c(=S)[nH]c3=O)[nH]2)cc1 |
| InChI | InChI=1S/C24H23N7O3S/c25-29-21(30-26)16-5-3-15(4-6-16)20-10-7-17(27-20)13-19-22(33)28-24(35)31(23(19)34)12-11-14-1-8-18(32)9-2-14/h1-10,13,25,27,30,32,34H,11-12,26H2,(H,28,33,35)/b17-13+,20-15-,21-16+,29-25+ |
| InChIKey | BWPZCMWZFSPNBJ-SRWJDUFBSA-N |
| XLogP | 1.56 |
| TPSA | 168.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|