C20H13FN6O2 — CID 153343358
5-[4-fluoro-3-(2H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 153343358) has the molecular formula C20H13FN6O2 and a molecular weight of 388.36 g/mol. Its IUPAC name is 5-[4-fluoro-3-(2H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[4-fluoro-3-(2H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 153343358 |
| Molecular Formula | C20H13FN6O2 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-[4-fluoro-3-(2H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccc(F)c(-c3nn[nH]n3)c2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C20H13FN6O2/c21-15-7-6-12(9-14(15)20-23-25-26-24-20)27-16-8-5-11-3-1-2-4-13(11)19(16)22-17(28)10-18(27)29/h1-9H,10H2,(H,22,28)(H,23,24,25,26) |
| InChIKey | ZTTTVELIDFZFKP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|