About 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine
2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine (PubChem CID 153343470) has the molecular formula C19H19N4OS+
and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine.
Molecular Properties
| Compound Name | 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine |
| PubChem CID | 153343470 |
| Molecular Formula | C19H19N4OS+ |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine |
| SMILES | CN1C(=Cc2nc[n+](OCCN)c3ccccc23)Sc2ccccc21 |
| InChI | InChI=1S/C19H19N4OS/c1-22-17-8-4-5-9-18(17)25-19(22)12-15-14-6-2-3-7-16(14)23(13-21-15)24-11-10-20/h2-9,12-13H,10-11,20H2,1H3/q+1 |
| InChIKey | ZFTJPFNOQBBFKR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine?
The IUPAC name of 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine (CID 153343470) is 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine.
What is the SMILES notation for 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine?
The canonical SMILES for 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine is CN1C(=Cc2nc[n+](OCCN)c3ccccc23)Sc2ccccc21.
What is the InChIKey of 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine?
The InChIKey is ZFTJPFNOQBBFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N4OS/c1-22-17-8-4-5-9-18(17)25-19(22)12-15-14-6-2-3-7-16(14)23(13-21-15)24-11-10-20/h2-9,12-13H,10-11,20H2,1H3/q+1.
What are the key properties of 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine?
2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine has a molecular weight of 351.46 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]quinazolin-1-ium-1-yl]oxyethanamine is sourced from PubChem (CID 153343470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).