C22H28N4 — CID 153343552
N-[2-[(E)-but-1-enyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine (PubChem CID 153343552) has the molecular formula C22H28N4 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-[(E)-but-1-enyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-[(E)-but-1-enyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 153343552 |
| Molecular Formula | C22H28N4 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-[2-[(E)-but-1-enyl]benzo[g]quinazolin-4-yl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CC/C=C/c1nc(NCCN(CC)CC)c2cc3ccccc3cc2n1 |
| InChI | InChI=1S/C22H28N4/c1-4-7-12-21-24-20-16-18-11-9-8-10-17(18)15-19(20)22(25-21)23-13-14-26(5-2)6-3/h7-12,15-16H,4-6,13-14H2,1-3H3,(H,23,24,25)/b12-7+ |
| InChIKey | NPTACAXFYJNVDT-KPKJPENVSA-N |
| XLogP | 4.96 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|