C16H18FN5O2 — CID 153343819
ethyl 3-[(6-cyclopropyl-5-fluoroimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dihydrotriazole-5-carboxylate (PubChem CID 153343819) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is ethyl 3-[(6-cyclopropyl-5-fluoroimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dihydrotriazole-5-carboxylate.
| Compound Name | ethyl 3-[(6-cyclopropyl-5-fluoroimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dihydrotriazole-5-carboxylate |
|---|---|
| PubChem CID | 153343819 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 3-[(6-cyclopropyl-5-fluoroimidazo[1,2-a]pyridin-2-yl)methyl]-1,2-dihydrotriazole-5-carboxylate |
| SMILES | CCOC(=O)C1=CN(Cc2cn3c(F)c(C4CC4)ccc3n2)NN1 |
| InChI | InChI=1S/C16H18FN5O2/c1-2-24-16(23)13-9-21(20-19-13)7-11-8-22-14(18-11)6-5-12(15(22)17)10-3-4-10/h5-6,8-10,19-20H,2-4,7H2,1H3 |
| InChIKey | ZPNAVCBDLVFHSI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|