C16H21CsFN5OS — CID 153344093
cesium;carbanide;N-[5-[[3-[(5-fluoropyrimidin-2-yl)methyl]pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 153344093) has the molecular formula C16H21CsFN5OS and a molecular weight of 483.35 g/mol. Its IUPAC name is cesium;carbanide;N-[5-[[3-[(5-fluoropyrimidin-2-yl)methyl]pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | cesium;carbanide;N-[5-[[3-[(5-fluoropyrimidin-2-yl)methyl]pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 153344093 |
| Molecular Formula | C16H21CsFN5OS |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | cesium;carbanide;N-[5-[[3-[(5-fluoropyrimidin-2-yl)methyl]pyrrolidin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CCC(Cc3ncc(F)cn3)C2)s1.[CH3-].[Cs+] |
| InChI | InChI=1S/C15H18FN5OS.CH3.Cs/c1-10(22)20-15-19-7-13(23-15)9-21-3-2-11(8-21)4-14-17-5-12(16)6-18-14;;/h5-7,11H,2-4,8-9H2,1H3,(H,19,20,22);1H3;/q;-1;+1 |
| InChIKey | PDOXGALZEQAQMW-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|