C17H29NO — CID 153344153
ethane;N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-N,2-dimethylpropanamide (PubChem CID 153344153) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is ethane;N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-N,2-dimethylpropanamide.
| Compound Name | ethane;N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 153344153 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | ethane;N-(1,2,3,4,5,6-hexahydronaphthalen-1-yl)-N,2-dimethylpropanamide |
| SMILES | CC.CC(C)C(=O)N(C)C1CCCC2=C1C=CCC2 |
| InChI | InChI=1S/C15H23NO.C2H6/c1-11(2)15(17)16(3)14-10-6-8-12-7-4-5-9-13(12)14;1-2/h5,9,11,14H,4,6-8,10H2,1-3H3;1-2H3 |
| InChIKey | FJBKXCJWBKNDER-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |