About ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane
ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane (PubChem CID 153344287) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| PubChem CID | 153344287 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane |
| SMILES | CC.CC1COC2(CCNCC2)CN1 |
| InChI | InChI=1S/C9H18N2O.C2H6/c1-8-6-12-9(7-11-8)2-4-10-5-3-9;1-2/h8,10-11H,2-7H2,1H3;1-2H3 |
| InChIKey | JNGYZOGEIBBWJI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane?
The IUPAC name of ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane (CID 153344287) is ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane.
What is the SMILES notation for ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane?
The canonical SMILES for ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane is CC.CC1COC2(CCNCC2)CN1.
What is the InChIKey of ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane?
The InChIKey is JNGYZOGEIBBWJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O.C2H6/c1-8-6-12-9(7-11-8)2-4-10-5-3-9;1-2/h8,10-11H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane?
ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane has a molecular weight of 200.33 g/mol, XLogP of 1.14, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-1-oxa-4,9-diazaspiro[5.5]undecane is sourced from PubChem (CID 153344287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).