About (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene
(3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene (PubChem CID 153344452) has the molecular formula C19H26BrF3
and a molecular weight of 391.32 g/mol. Its IUPAC name is (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene |
| PubChem CID | 153344452 |
| Molecular Formula | C19H26BrF3 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene |
| SMILES | C=C(C)/C=C\C(=C)Br.CC.CC(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3.C7H9Br.C2H6/c1-7(2)8-3-5-9(6-4-8)10(11,12)13;1-6(2)4-5-7(3)8;1-2/h3-7H,1-2H3;4-5H,1,3H2,2H3;1-2H3/b;5-4-; |
| InChIKey | XCHANFYFOHWHHX-FXHNQCOHSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene?
The IUPAC name of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene (CID 153344452) is (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene.
What is the SMILES notation for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene?
The canonical SMILES for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene is C=C(C)/C=C\C(=C)Br.CC.CC(C)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene?
The InChIKey is XCHANFYFOHWHHX-FXHNQCOHSA-N. The full InChI is InChI=1S/C10H11F3.C7H9Br.C2H6/c1-7(2)8-3-5-9(6-4-8)10(11,12)13;1-6(2)4-5-7(3)8;1-2/h3-7H,1-2H3;4-5H,1,3H2,2H3;1-2H3/b;5-4-;.
What are the key properties of (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene?
(3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene has a molecular weight of 391.32 g/mol, XLogP of 7.88, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-2-bromo-5-methylhexa-1,3,5-triene;ethane;1-propan-2-yl-4-(trifluoromethyl)benzene is sourced from PubChem (CID 153344452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).