C25H45N3O3 — CID 153344596
4-cyclopropyl-9-[(Z)-4-hydroxy-3-methylpent-3-enyl]-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;N-ethylpent-4-en-1-amine (PubChem CID 153344596) has the molecular formula C25H45N3O3 and a molecular weight of 435.65 g/mol. Its IUPAC name is 4-cyclopropyl-9-[(Z)-4-hydroxy-3-methylpent-3-enyl]-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;N-ethylpent-4-en-1-amine.
| Compound Name | 4-cyclopropyl-9-[(Z)-4-hydroxy-3-methylpent-3-enyl]-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;N-ethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 153344596 |
| Molecular Formula | C25H45N3O3 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.35 |
| IUPAC Name | 4-cyclopropyl-9-[(Z)-4-hydroxy-3-methylpent-3-enyl]-2-methyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one;N-ethylpent-4-en-1-amine |
| SMILES | C/C(O)=C(\C)CCN1CCC2(CC1)CN(C1CC1)C(=O)C(C)O2.C=CCCCNCC |
| InChI | InChI=1S/C18H30N2O3.C7H15N/c1-13(14(2)21)6-9-19-10-7-18(8-11-19)12-20(16-4-5-16)17(22)15(3)23-18;1-3-5-6-7-8-4-2/h15-16,21H,4-12H2,1-3H3;3,8H,1,4-7H2,2H3/b14-13-; |
| InChIKey | ORKIPFRORPBQKY-HPWRNOGASA-N |
| XLogP | 4.03 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|