About (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol
(3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol (PubChem CID 153344724) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol.
Molecular Properties
| Compound Name | (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol |
| PubChem CID | 153344724 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol |
| SMILES | C=C(O)/C(N)=c1\c(=C)c2ccccc2c(=C/C)/c1=C\C |
| InChI | InChI=1S/C18H19NO/c1-5-13-14(6-2)17(18(19)12(4)20)11(3)15-9-7-8-10-16(13)15/h5-10,20H,3-4,19H2,1-2H3/b13-5+,14-6+,18-17- |
| InChIKey | HLRQODBWCUCXAM-NFNYSQBBSA-N |
| XLogP | 0.99 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol?
The IUPAC name of (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol (CID 153344724) is (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol.
What is the SMILES notation for (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol?
The canonical SMILES for (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol is C=C(O)/C(N)=c1\c(=C)c2ccccc2c(=C/C)/c1=C\C.
What is the InChIKey of (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol?
The InChIKey is HLRQODBWCUCXAM-NFNYSQBBSA-N. The full InChI is InChI=1S/C18H19NO/c1-5-13-14(6-2)17(18(19)12(4)20)11(3)15-9-7-8-10-16(13)15/h5-10,20H,3-4,19H2,1-2H3/b13-5+,14-6+,18-17-.
What are the key properties of (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol?
(3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol has a molecular weight of 265.36 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-amino-3-[(3E,4Z)-3,4-di(ethylidene)-1-methylidenenaphthalen-2-ylidene]prop-1-en-2-ol is sourced from PubChem (CID 153344724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).