About [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine
[(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine (PubChem CID 153344824) has the molecular formula C10H12FN5O
and a molecular weight of 237.24 g/mol. Its IUPAC name is [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine.
Molecular Properties
| Compound Name | [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine |
| PubChem CID | 153344824 |
| Molecular Formula | C10H12FN5O |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine |
| SMILES | NC[C@@H]1C[C@@H](F)[C@H](n2cnc3cncnc32)O1 |
| InChI | InChI=1S/C10H12FN5O/c11-7-1-6(2-12)17-10(7)16-5-15-8-3-13-4-14-9(8)16/h3-7,10H,1-2,12H2/t6-,7+,10+/m0/s1 |
| InChIKey | YVTMYCFEDYWBCU-NYNCVSEMSA-N |
| XLogP | 0.41 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine?
The IUPAC name of [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine (CID 153344824) is [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine.
What is the SMILES notation for [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine?
The canonical SMILES for [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine is NC[C@@H]1C[C@@H](F)[C@H](n2cnc3cncnc32)O1.
What is the InChIKey of [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine?
The InChIKey is YVTMYCFEDYWBCU-NYNCVSEMSA-N. The full InChI is InChI=1S/C10H12FN5O/c11-7-1-6(2-12)17-10(7)16-5-15-8-3-13-4-14-9(8)16/h3-7,10H,1-2,12H2/t6-,7+,10+/m0/s1.
What are the key properties of [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine?
[(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine has a molecular weight of 237.24 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4R,5R)-4-fluoro-5-purin-9-yloxolan-2-yl]methanamine is sourced from PubChem (CID 153344824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).