About 2-(furan-2-yl)furan-3,4-dicarboxylic acid
2-(furan-2-yl)furan-3,4-dicarboxylic acid (PubChem CID 153344951) has the molecular formula C10H6O6
and a molecular weight of 222.15 g/mol. Its IUPAC name is 2-(furan-2-yl)furan-3,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-(furan-2-yl)furan-3,4-dicarboxylic acid |
| PubChem CID | 153344951 |
| Molecular Formula | C10H6O6 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2-(furan-2-yl)furan-3,4-dicarboxylic acid |
| SMILES | O=C(O)c1coc(-c2ccco2)c1C(=O)O |
| InChI | InChI=1S/C10H6O6/c11-9(12)5-4-16-8(7(5)10(13)14)6-2-1-3-15-6/h1-4H,(H,11,12)(H,13,14) |
| InChIKey | PQYIMHIDNJETHC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(furan-2-yl)furan-3,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)furan-3,4-dicarboxylic acid?
The IUPAC name of 2-(furan-2-yl)furan-3,4-dicarboxylic acid (CID 153344951) is 2-(furan-2-yl)furan-3,4-dicarboxylic acid.
What is the SMILES notation for 2-(furan-2-yl)furan-3,4-dicarboxylic acid?
The canonical SMILES for 2-(furan-2-yl)furan-3,4-dicarboxylic acid is O=C(O)c1coc(-c2ccco2)c1C(=O)O.
What is the InChIKey of 2-(furan-2-yl)furan-3,4-dicarboxylic acid?
The InChIKey is PQYIMHIDNJETHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O6/c11-9(12)5-4-16-8(7(5)10(13)14)6-2-1-3-15-6/h1-4H,(H,11,12)(H,13,14).
What are the key properties of 2-(furan-2-yl)furan-3,4-dicarboxylic acid?
2-(furan-2-yl)furan-3,4-dicarboxylic acid has a molecular weight of 222.15 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)furan-3,4-dicarboxylic acid is sourced from PubChem (CID 153344951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).