C17H15F2NO4S — CID 15334507
[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15334507) has the molecular formula C17H15F2NO4S and a molecular weight of 367.37 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15334507 |
| Molecular Formula | C17H15F2NO4S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | [2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C17H15F2NO4S/c1-11-5-7-13(8-6-11)25(21,22)24-10-12-9-23-17(20-12)16-14(18)3-2-4-15(16)19/h2-8,12H,9-10H2,1H3 |
| InChIKey | OUYWAAACKIGVKE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|