C25H27N5O2 — CID 153345105
5-[(4-ethenylidene-6,7-dihydro-5H-pyrimido[4,5-b]azepin-3-yl)methyl]-3-[(3R,5R)-3-ethyl-5-phenyloxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 153345105) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-[(4-ethenylidene-6,7-dihydro-5H-pyrimido[4,5-b]azepin-3-yl)methyl]-3-[(3R,5R)-3-ethyl-5-phenyloxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-[(4-ethenylidene-6,7-dihydro-5H-pyrimido[4,5-b]azepin-3-yl)methyl]-3-[(3R,5R)-3-ethyl-5-phenyloxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 153345105 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 5-[(4-ethenylidene-6,7-dihydro-5H-pyrimido[4,5-b]azepin-3-yl)methyl]-3-[(3R,5R)-3-ethyl-5-phenyloxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | C=C=C1C2=C(N=CCCC2)N=CN1Cc1nc([C@]2(CC)CO[C@@H](c3ccccc3)C2)no1 |
| InChI | InChI=1S/C25H27N5O2/c1-3-20-19-12-8-9-13-26-23(19)27-17-30(20)15-22-28-24(29-32-22)25(4-2)14-21(31-16-25)18-10-6-5-7-11-18/h5-7,10-11,13,17,21H,1,4,8-9,12,14-16H2,2H3/t21-,25+/m1/s1 |
| InChIKey | AUJHMDPNIPOWQI-BWKNWUBXSA-N |
| XLogP | 4.86 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |