C29H45F4NO2 — CID 153346131
1,1-dimethylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol;1-(2,2,3,3-tetrafluorocyclobutyl)butan-2-one (PubChem CID 153346131) has the molecular formula C29H45F4NO2 and a molecular weight of 515.68 g/mol. Its IUPAC name is 1,1-dimethylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol;1-(2,2,3,3-tetrafluorocyclobutyl)butan-2-one.
| Compound Name | 1,1-dimethylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol;1-(2,2,3,3-tetrafluorocyclobutyl)butan-2-one |
|---|---|
| PubChem CID | 153346131 |
| Molecular Formula | C29H45F4NO2 |
| Molecular Weight | 515.68 g/mol |
| Exact Mass | 515.34 |
| IUPAC Name | 1,1-dimethylcyclobutane;2-[3-methyl-4-(pentan-2-ylideneamino)phenyl]propan-2-ol;1-(2,2,3,3-tetrafluorocyclobutyl)butan-2-one |
| SMILES | CC1(C)CCC1.CCC(=O)CC1CC(F)(F)C1(F)F.CCC/C(C)=N/c1ccc(C(C)(C)O)cc1C |
| InChI | InChI=1S/C15H23NO.C8H10F4O.C6H12/c1-6-7-12(3)16-14-9-8-13(10-11(14)2)15(4,5)17;1-2-6(13)3-5-4-7(9,10)8(5,11)12;1-6(2)4-3-5-6/h8-10,17H,6-7H2,1-5H3;5H,2-4H2,1H3;3-5H2,1-2H3/b16-12+;; |
| InChIKey | TZRRAWYHJLQXPN-LPMXOWGUSA-N |
| XLogP | 8.96 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|