C27H28FN3O3 — CID 153346136
(3S)-N-(6-cyclobutyl-14-fluoro-13-methylidene-15-oxa-4,6-diazatetracyclo[7.6.0.03,7.010,12]pentadeca-1,3(7),4,8-tetraen-5-yl)-3-hydroxy-3-phenylbutanamide (PubChem CID 153346136) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is (3S)-N-(6-cyclobutyl-14-fluoro-13-methylidene-15-oxa-4,6-diazatetracyclo[7.6.0.03,7.010,12]pentadeca-1,3(7),4,8-tetraen-5-yl)-3-hydroxy-3-phenylbutanamide.
| Compound Name | (3S)-N-(6-cyclobutyl-14-fluoro-13-methylidene-15-oxa-4,6-diazatetracyclo[7.6.0.03,7.010,12]pentadeca-1,3(7),4,8-tetraen-5-yl)-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 153346136 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (3S)-N-(6-cyclobutyl-14-fluoro-13-methylidene-15-oxa-4,6-diazatetracyclo[7.6.0.03,7.010,12]pentadeca-1,3(7),4,8-tetraen-5-yl)-3-hydroxy-3-phenylbutanamide |
| SMILES | C=C1C(F)Oc2cc3nc(NC(=O)C[C@](C)(O)c4ccccc4)n(C4CCC4)c3cc2C2CC12 |
| InChI | InChI=1S/C27H28FN3O3/c1-15-18-11-19(18)20-12-22-21(13-23(20)34-25(15)28)29-26(31(22)17-9-6-10-17)30-24(32)14-27(2,33)16-7-4-3-5-8-16/h3-5,7-8,12-13,17-19,25,33H,1,6,9-11,14H2,2H3,(H,29,30,32)/t18?,19?,25?,27-/m0/s1 |
| InChIKey | JEHNGYIOHWMTSM-FECYQZAMSA-N |
| XLogP | 5.35 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|