C18H28F3N — CID 153346196
N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine (PubChem CID 153346196) has the molecular formula C18H28F3N and a molecular weight of 315.42 g/mol. Its IUPAC name is N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine.
| Compound Name | N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine |
|---|---|
| PubChem CID | 153346196 |
| Molecular Formula | C18H28F3N |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | N-[(2E,4E,6E)-1,1,1-trifluoro-2,6-dimethyldeca-2,4,6-trien-5-yl]hexan-2-imine |
| SMILES | CCC/C=C(C)/C(=C\C=C(/C)C(F)(F)F)/N=C(\C)CCCC |
| InChI | InChI=1S/C18H28F3N/c1-6-8-10-14(3)17(22-16(5)11-9-7-2)13-12-15(4)18(19,20)21/h10,12-13H,6-9,11H2,1-5H3/b14-10+,15-12+,17-13+,22-16+ |
| InChIKey | KWESUPSSQODEMJ-FZUIMXHBSA-N |
| XLogP | 6.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|