About ethane;3-propyl-1,2,4-oxadiazol-5-amine
ethane;3-propyl-1,2,4-oxadiazol-5-amine (PubChem CID 153346311) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is ethane;3-propyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | ethane;3-propyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 153346311 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | ethane;3-propyl-1,2,4-oxadiazol-5-amine |
| SMILES | CC.CCCc1noc(N)n1 |
| InChI | InChI=1S/C5H9N3O.C2H6/c1-2-3-4-7-5(6)9-8-4;1-2/h2-3H2,1H3,(H2,6,7,8);1-2H3 |
| InChIKey | ZLPNBWUJQVWGPE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;3-propyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-propyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of ethane;3-propyl-1,2,4-oxadiazol-5-amine (CID 153346311) is ethane;3-propyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for ethane;3-propyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for ethane;3-propyl-1,2,4-oxadiazol-5-amine is CC.CCCc1noc(N)n1.
What is the InChIKey of ethane;3-propyl-1,2,4-oxadiazol-5-amine?
The InChIKey is ZLPNBWUJQVWGPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O.C2H6/c1-2-3-4-7-5(6)9-8-4;1-2/h2-3H2,1H3,(H2,6,7,8);1-2H3.
What are the key properties of ethane;3-propyl-1,2,4-oxadiazol-5-amine?
ethane;3-propyl-1,2,4-oxadiazol-5-amine has a molecular weight of 157.22 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-propyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 153346311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).