C8H19BO2 — CID 153346336
ethane;2,4,6-trimethyl-1,3,2-dioxaborinane (PubChem CID 153346336) has the molecular formula C8H19BO2 and a molecular weight of 158.05 g/mol. Its IUPAC name is ethane;2,4,6-trimethyl-1,3,2-dioxaborinane.
| Compound Name | ethane;2,4,6-trimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 153346336 |
| Molecular Formula | C8H19BO2 |
| Molecular Weight | 158.05 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | ethane;2,4,6-trimethyl-1,3,2-dioxaborinane |
| SMILES | CB1OC(C)CC(C)O1.CC |
| InChI | InChI=1S/C6H13BO2.C2H6/c1-5-4-6(2)9-7(3)8-5;1-2/h5-6H,4H2,1-3H3;1-2H3 |
| InChIKey | FCVPHPKRUQVRJI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.05 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|